About 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one
5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one (PubChem CID 3578642) has the molecular formula C23H17BrN4O
and a molecular weight of 445.32 g/mol. Its IUPAC name is 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one |
| PubChem CID | 3578642 |
| Molecular Formula | C23H17BrN4O |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(Nc3ccccc3-c3nc4ccccc4n32)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H17BrN4O/c1-2-27-19-12-11-14(24)13-16(19)23(22(27)29)26-17-8-4-3-7-15(17)21-25-18-9-5-6-10-20(18)28(21)23/h3-13,26H,2H2,1H3 |
| InChIKey | JAOXMWQGHOIFKC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one?
The IUPAC name of 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one (CID 3578642) is 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one.
What is the SMILES notation for 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one?
The canonical SMILES for 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one is CCN1C(=O)C2(Nc3ccccc3-c3nc4ccccc4n32)c2cc(Br)ccc21.
What is the InChIKey of 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one?
The InChIKey is JAOXMWQGHOIFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17BrN4O/c1-2-27-19-12-11-14(24)13-16(19)23(22(27)29)26-17-8-4-3-7-15(17)21-25-18-9-5-6-10-20(18)28(21)23/h3-13,26H,2H2,1H3.
What are the key properties of 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one?
5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one has a molecular weight of 445.32 g/mol, XLogP of 4.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-bromo-1'-ethylspiro[5H-benzimidazolo[1,2-c]quinazoline-6,3'-indole]-2'-one is sourced from PubChem (CID 3578642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).