C6H8F5NO — CID 3578709
2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide (PubChem CID 3578709) has the molecular formula C6H8F5NO and a molecular weight of 205.13 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 3578709 |
| Molecular Formula | C6H8F5NO |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO/c1-3(2)12-4(13)5(7,8)6(9,10)11/h3H,1-2H3,(H,12,13) |
| InChIKey | SEUHGSNLQTVWRL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|