About N'-(5-bromo-1,3-thiazol-2-yl)oxamide
N'-(5-bromo-1,3-thiazol-2-yl)oxamide (PubChem CID 3578769) has the molecular formula C5H4BrN3O2S
and a molecular weight of 250.08 g/mol. Its IUPAC name is N'-(5-bromo-1,3-thiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N'-(5-bromo-1,3-thiazol-2-yl)oxamide |
| PubChem CID | 3578769 |
| Molecular Formula | C5H4BrN3O2S |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 248.92 |
| IUPAC Name | N'-(5-bromo-1,3-thiazol-2-yl)oxamide |
| SMILES | NC(=O)C(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C5H4BrN3O2S/c6-2-1-8-5(12-2)9-4(11)3(7)10/h1H,(H2,7,10)(H,8,9,11) |
| InChIKey | ZORWZGCZCJRADC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-bromo-1,3-thiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-bromo-1,3-thiazol-2-yl)oxamide?
The IUPAC name of N'-(5-bromo-1,3-thiazol-2-yl)oxamide (CID 3578769) is N'-(5-bromo-1,3-thiazol-2-yl)oxamide.
What is the SMILES notation for N'-(5-bromo-1,3-thiazol-2-yl)oxamide?
The canonical SMILES for N'-(5-bromo-1,3-thiazol-2-yl)oxamide is NC(=O)C(=O)Nc1ncc(Br)s1.
What is the InChIKey of N'-(5-bromo-1,3-thiazol-2-yl)oxamide?
The InChIKey is ZORWZGCZCJRADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrN3O2S/c6-2-1-8-5(12-2)9-4(11)3(7)10/h1H,(H2,7,10)(H,8,9,11).
What are the key properties of N'-(5-bromo-1,3-thiazol-2-yl)oxamide?
N'-(5-bromo-1,3-thiazol-2-yl)oxamide has a molecular weight of 250.08 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-bromo-1,3-thiazol-2-yl)oxamide is sourced from PubChem (CID 3578769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).