C14H10F3N5O3 — CID 3579305
N-(1,3-dimethyl-2,4-dioxobenzo[g]pteridin-8-yl)-2,2,2-trifluoroacetamide (PubChem CID 3579305) has the molecular formula C14H10F3N5O3 and a molecular weight of 353.26 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,4-dioxobenzo[g]pteridin-8-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1,3-dimethyl-2,4-dioxobenzo[g]pteridin-8-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 3579305 |
| Molecular Formula | C14H10F3N5O3 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-(1,3-dimethyl-2,4-dioxobenzo[g]pteridin-8-yl)-2,2,2-trifluoroacetamide |
| SMILES | Cn1c(=O)c2nc3ccc(NC(=O)C(F)(F)F)cc3nc2n(C)c1=O |
| InChI | InChI=1S/C14H10F3N5O3/c1-21-10-9(11(23)22(2)13(21)25)19-7-4-3-6(5-8(7)20-10)18-12(24)14(15,16)17/h3-5H,1-2H3,(H,18,24) |
| InChIKey | OLUYJDBGWYPMNW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|