C23H28N4O5 — CID 35793790
1-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-N-[(E)-(4-nitrophenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 35793790) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-N-[(E)-(4-nitrophenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-N-[(E)-(4-nitrophenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 35793790 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-N-[(E)-(4-nitrophenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])cc1)C1CCN(C[C@@H](O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N4O5/c28-22(17-32-16-19-4-2-1-3-5-19)15-26-12-10-20(11-13-26)23(29)25-24-14-18-6-8-21(9-7-18)27(30)31/h1-9,14,20,22,28H,10-13,15-17H2,(H,25,29)/b24-14+/t22-/m1/s1 |
| InChIKey | BKUFLSGDQZEVAA-SGCYSOCQSA-N |
| XLogP | 2.33 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|