About N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide
N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide (PubChem CID 35794344) has the molecular formula C4H5ClN4OS
and a molecular weight of 192.63 g/mol. Its IUPAC name is N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide.
Molecular Properties
| Compound Name | N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide |
| PubChem CID | 35794344 |
| Molecular Formula | C4H5ClN4OS |
| Molecular Weight | 192.63 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide |
| SMILES | Nc1nc(NC(=O)CCl)ns1 |
| InChI | InChI=1S/C4H5ClN4OS/c5-1-2(10)7-4-8-3(6)11-9-4/h1H2,(H3,6,7,8,9,10) |
| InChIKey | OPOQXJZIOGZIDF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.63 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide?
The IUPAC name of N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide (CID 35794344) is N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide.
What is the SMILES notation for N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide?
The canonical SMILES for N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide is Nc1nc(NC(=O)CCl)ns1.
What is the InChIKey of N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide?
The InChIKey is OPOQXJZIOGZIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN4OS/c5-1-2(10)7-4-8-3(6)11-9-4/h1H2,(H3,6,7,8,9,10).
What are the key properties of N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide?
N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide has a molecular weight of 192.63 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloroacetamide is sourced from PubChem (CID 35794344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).