About 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid
5,5-dioxodibenzothiophene-2,8-dicarboxylic acid (PubChem CID 3579602) has the molecular formula C14H8O6S
and a molecular weight of 304.28 g/mol. Its IUPAC name is 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid.
Molecular Properties
| Compound Name | 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid |
| PubChem CID | 3579602 |
| Molecular Formula | C14H8O6S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)-c1cc(C(=O)O)ccc1S2(=O)=O |
| InChI | InChI=1S/C14H8O6S/c15-13(16)7-1-3-11-9(5-7)10-6-8(14(17)18)2-4-12(10)21(11,19)20/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | HLYRFUQKRBQPDX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid?
The IUPAC name of 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid (CID 3579602) is 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid.
What is the SMILES notation for 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid?
The canonical SMILES for 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid is O=C(O)c1ccc2c(c1)-c1cc(C(=O)O)ccc1S2(=O)=O.
What is the InChIKey of 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid?
The InChIKey is HLYRFUQKRBQPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O6S/c15-13(16)7-1-3-11-9(5-7)10-6-8(14(17)18)2-4-12(10)21(11,19)20/h1-6H,(H,15,16)(H,17,18).
What are the key properties of 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid?
5,5-dioxodibenzothiophene-2,8-dicarboxylic acid has a molecular weight of 304.28 g/mol, XLogP of 1.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dioxodibenzothiophene-2,8-dicarboxylic acid is sourced from PubChem (CID 3579602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).