About 6-iodo-2,3-dihydrochromen-4-one
6-iodo-2,3-dihydrochromen-4-one (PubChem CID 3580262) has the molecular formula C9H7IO2
and a molecular weight of 274.06 g/mol. Its IUPAC name is 6-iodo-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-iodo-2,3-dihydrochromen-4-one |
| PubChem CID | 3580262 |
| Molecular Formula | C9H7IO2 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | 6-iodo-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2ccc(I)cc21 |
| InChI | InChI=1S/C9H7IO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| InChIKey | SDUOLEARZNZVAN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2,3-dihydrochromen-4-one?
The IUPAC name of 6-iodo-2,3-dihydrochromen-4-one (CID 3580262) is 6-iodo-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-iodo-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-iodo-2,3-dihydrochromen-4-one is O=C1CCOc2ccc(I)cc21.
What is the InChIKey of 6-iodo-2,3-dihydrochromen-4-one?
The InChIKey is SDUOLEARZNZVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2.
What are the key properties of 6-iodo-2,3-dihydrochromen-4-one?
6-iodo-2,3-dihydrochromen-4-one has a molecular weight of 274.06 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2,3-dihydrochromen-4-one is sourced from PubChem (CID 3580262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).