C24H20F3N3O2 — CID 35805286
2-[2-(phenoxymethyl)benzimidazol-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 35805286) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-[2-(phenoxymethyl)benzimidazol-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[2-(phenoxymethyl)benzimidazol-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 35805286 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[2-(phenoxymethyl)benzimidazol-1-yl]-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cn1c(COc2ccccc2)nc2ccccc21)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F3N3O2/c25-24(26,27)18-8-6-7-17(13-18)14-28-23(31)15-30-21-12-5-4-11-20(21)29-22(30)16-32-19-9-2-1-3-10-19/h1-13H,14-16H2,(H,28,31) |
| InChIKey | BODVKQPOHQIFLO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |