About (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate
(3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate (PubChem CID 35809575) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate.
Molecular Properties
| Compound Name | (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate |
| PubChem CID | 35809575 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate |
| SMILES | CC(=O)c1c(C)cc(C)c(COC(=O)c2cnc(C)cn2)c1C |
| InChI | InChI=1S/C18H20N2O3/c1-10-6-11(2)17(14(5)21)13(4)15(10)9-23-18(22)16-8-19-12(3)7-20-16/h6-8H,9H2,1-5H3 |
| InChIKey | NMGIOPDEXYPXQI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate?
The IUPAC name of (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate (CID 35809575) is (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate.
What is the SMILES notation for (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate?
The canonical SMILES for (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate is CC(=O)c1c(C)cc(C)c(COC(=O)c2cnc(C)cn2)c1C.
What is the InChIKey of (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate?
The InChIKey is NMGIOPDEXYPXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3/c1-10-6-11(2)17(14(5)21)13(4)15(10)9-23-18(22)16-8-19-12(3)7-20-16/h6-8H,9H2,1-5H3.
What are the key properties of (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate?
(3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate has a molecular weight of 312.37 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-2,4,6-trimethylphenyl)methyl 5-methylpyrazine-2-carboxylate is sourced from PubChem (CID 35809575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).