About azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone
azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone (PubChem CID 35810279) has the molecular formula C20H25N3O3
and a molecular weight of 355.44 g/mol. Its IUPAC name is azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone.
Molecular Properties
| Compound Name | azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone |
| PubChem CID | 35810279 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone |
| SMILES | Cn1cc(C(=O)N2CCCCCC2)c(-c2ccc3c(c2)OCCCO3)n1 |
| InChI | InChI=1S/C20H25N3O3/c1-22-14-16(20(24)23-9-4-2-3-5-10-23)19(21-22)15-7-8-17-18(13-15)26-12-6-11-25-17/h7-8,13-14H,2-6,9-12H2,1H3 |
| InChIKey | MNABPVVUYNSLRE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone?
The IUPAC name of azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone (CID 35810279) is azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone.
What is the SMILES notation for azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone?
The canonical SMILES for azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone is Cn1cc(C(=O)N2CCCCCC2)c(-c2ccc3c(c2)OCCCO3)n1.
What is the InChIKey of azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone?
The InChIKey is MNABPVVUYNSLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O3/c1-22-14-16(20(24)23-9-4-2-3-5-10-23)19(21-22)15-7-8-17-18(13-15)26-12-6-11-25-17/h7-8,13-14H,2-6,9-12H2,1H3.
What are the key properties of azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone?
azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone has a molecular weight of 355.44 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-methylpyrazol-4-yl]methanone is sourced from PubChem (CID 35810279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).