C21H18F2N2O3S — CID 3581200
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 3581200) has the molecular formula C21H18F2N2O3S and a molecular weight of 416.45 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 3581200 |
| Molecular Formula | C21H18F2N2O3S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)c(F)c2)cs1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H18F2N2O3S/c22-17-8-5-14(10-18(17)23)19-12-29-21(24-19)25-20(26)13-3-6-15(7-4-13)28-11-16-2-1-9-27-16/h3-8,10,12,16H,1-2,9,11H2,(H,24,25,26) |
| InChIKey | KSIPTGMGRQLTEF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |