About morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone
morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 3581304) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone.
Molecular Properties
| Compound Name | morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone |
| PubChem CID | 3581304 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)N1CCOCC1 |
| InChI | InChI=1S/C7H10N4O2/c12-7(6-8-5-9-10-6)11-1-3-13-4-2-11/h5H,1-4H2,(H,8,9,10) |
| InChIKey | QAMJVOSESXUGTE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone?
The IUPAC name of morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone (CID 3581304) is morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone.
What is the SMILES notation for morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone?
The canonical SMILES for morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone is O=C(c1ncn[nH]1)N1CCOCC1.
What is the InChIKey of morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone?
The InChIKey is QAMJVOSESXUGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c12-7(6-8-5-9-10-6)11-1-3-13-4-2-11/h5H,1-4H2,(H,8,9,10).
What are the key properties of morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone?
morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone has a molecular weight of 182.18 g/mol, XLogP of -0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl(1H-1,2,4-triazol-5-yl)methanone is sourced from PubChem (CID 3581304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).