C15H13NO4S — CID 3581357
3-naphthalen-1-yl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one (PubChem CID 3581357) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-naphthalen-1-yl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one.
| Compound Name | 3-naphthalen-1-yl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 3581357 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-naphthalen-1-yl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1OC2CS(=O)(=O)CC2N1c1cccc2ccccc12 |
| InChI | InChI=1S/C15H13NO4S/c17-15-16(13-8-21(18,19)9-14(13)20-15)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-14H,8-9H2 |
| InChIKey | DREQGDDAZIYSNB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |