C26H26N6O5S2 — CID 3581790
2-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 3581790) has the molecular formula C26H26N6O5S2 and a molecular weight of 566.67 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3581790 |
| Molecular Formula | C26H26N6O5S2 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 2-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | CC1(C)Cc2c(c(N3CCOCC3)nc3sc4c(SCC(=O)Nc5ccccc5[N+](=O)[O-])ncnc4c23)CO1 |
| InChI | InChI=1S/C26H26N6O5S2/c1-26(2)11-15-16(12-37-26)23(31-7-9-36-10-8-31)30-24-20(15)21-22(39-24)25(28-14-27-21)38-13-19(33)29-17-5-3-4-6-18(17)32(34)35/h3-6,14H,7-13H2,1-2H3,(H,29,33) |
| InChIKey | XWESDNYLQNIJPW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|