C16H17BrN2OS — CID 35824178
N-(4-bromo-3-methylphenyl)-2-(2-methylsulfanylanilino)acetamide (PubChem CID 35824178) has the molecular formula C16H17BrN2OS and a molecular weight of 365.30 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(2-methylsulfanylanilino)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(2-methylsulfanylanilino)acetamide |
|---|---|
| PubChem CID | 35824178 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(2-methylsulfanylanilino)acetamide |
| SMILES | CSc1ccccc1NCC(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C16H17BrN2OS/c1-11-9-12(7-8-13(11)17)19-16(20)10-18-14-5-3-4-6-15(14)21-2/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | RBMPHDQWKCMVGR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |