C21H23ClN2O4 — CID 35825374
(2R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(5-chloro-2,4-dimethoxyanilino)propan-1-one (PubChem CID 35825374) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is (2R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(5-chloro-2,4-dimethoxyanilino)propan-1-one.
| Compound Name | (2R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(5-chloro-2,4-dimethoxyanilino)propan-1-one |
|---|---|
| PubChem CID | 35825374 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (2R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(5-chloro-2,4-dimethoxyanilino)propan-1-one |
| SMILES | COc1cc(OC)c(N[C@H](C)C(=O)c2ccc3c(c2)CCN3C(C)=O)cc1Cl |
| InChI | InChI=1S/C21H23ClN2O4/c1-12(23-17-10-16(22)19(27-3)11-20(17)28-4)21(26)15-5-6-18-14(9-15)7-8-24(18)13(2)25/h5-6,9-12,23H,7-8H2,1-4H3/t12-/m1/s1 |
| InChIKey | ZDYLUEYNAONBET-GFCCVEGCSA-N |
| XLogP | 3.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|