About Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate
Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate (PubChem CID 3582654) has the molecular formula C28H33NO4S
and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 4-[[(4-tert-butylphenyl)sulfonyl-[(2-methylphenyl)methyl]amino]methyl]benzoate.
Molecular Properties
| Compound Name | Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate |
| PubChem CID | 3582654 |
| Molecular Formula | C28H33NO4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | ethyl 4-[[(4-tert-butylphenyl)sulfonyl-[(2-methylphenyl)methyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)C1=CC=C(C=C1)CN(CC2=CC=CC=C2C)S(=O)(=O)C3=CC=C(C=C3)C(C)(C)C |
| InChI | InChI=1S/C28H33NO4S/c1-6-33-27(30)23-13-11-22(12-14-23)19-29(20-24-10-8-7-9-21(24)2)34(31,32)26-17-15-25(16-18-26)28(3,4)5/h7-18H,6,19-20H2,1-5H3 |
| InChIKey | QNAZBDJZUQXNMV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | 737 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate?
The IUPAC name of Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate (CID 3582654) is ethyl 4-[[(4-tert-butylphenyl)sulfonyl-[(2-methylphenyl)methyl]amino]methyl]benzoate.
What is the SMILES notation for Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate?
The canonical SMILES for Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate is CCOC(=O)C1=CC=C(C=C1)CN(CC2=CC=CC=C2C)S(=O)(=O)C3=CC=C(C=C3)C(C)(C)C.
What is the InChIKey of Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate?
The InChIKey is QNAZBDJZUQXNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33NO4S/c1-6-33-27(30)23-13-11-22(12-14-23)19-29(20-24-10-8-7-9-21(24)2)34(31,32)26-17-15-25(16-18-26)28(3,4)5/h7-18H,6,19-20H2,1-5H3.
What are the key properties of Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate?
Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate has a molecular weight of 479.60 g/mol, XLogP of 6.30, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 4-({N-[(2-methylphenyl)methyl]4-tert-butylbenzenesulfonamido}methyl)benzoate is sourced from PubChem (CID 3582654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).