C27H33N3O5 — CID 3582866
ethyl 1-[3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzoyl]piperidine-3-carboxylate (PubChem CID 3582866) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is ethyl 1-[3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 3582866 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | ethyl 1-[3-[[2-(3-methoxypropyl)-3-oxo-1H-isoindol-1-yl]amino]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cccc(NC3c4ccccc4C(=O)N3CCCOC)c2)C1 |
| InChI | InChI=1S/C27H33N3O5/c1-3-35-27(33)20-10-7-14-29(18-20)25(31)19-9-6-11-21(17-19)28-24-22-12-4-5-13-23(22)26(32)30(24)15-8-16-34-2/h4-6,9,11-13,17,20,24,28H,3,7-8,10,14-16,18H2,1-2H3 |
| InChIKey | RMFMZQJLLPCUGT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|