About 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline
8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 3584202) has the molecular formula C11H8N4O2
and a molecular weight of 228.21 g/mol. Its IUPAC name is 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline |
| PubChem CID | 3584202 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | Cc1cc(N=[N+]=[N-])c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C11H8N4O2/c1-6-2-9(14-15-12)7-3-10-11(17-5-16-10)4-8(7)13-6/h2-4H,5H2,1H3 |
| InChIKey | PHXLKYMEDNPPIJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline?
The IUPAC name of 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline (CID 3584202) is 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline.
What is the SMILES notation for 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline?
The canonical SMILES for 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline is Cc1cc(N=[N+]=[N-])c2cc3c(cc2n1)OCO3.
What is the InChIKey of 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline?
The InChIKey is PHXLKYMEDNPPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2/c1-6-2-9(14-15-12)7-3-10-11(17-5-16-10)4-8(7)13-6/h2-4H,5H2,1H3.
What are the key properties of 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline?
8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline has a molecular weight of 228.21 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azido-6-methyl-[1,3]dioxolo[4,5-g]quinoline is sourced from PubChem (CID 3584202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).