About 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one
6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 3584203) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 3584203 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2nc(-c3ccc4c(c3)NC(=O)CO4)cn2c1 |
| InChI | InChI=1S/C16H13N3O2/c1-10-2-5-15-17-13(8-19(15)7-10)11-3-4-14-12(6-11)18-16(20)9-21-14/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | RUIVPKHWWWKTPM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one (CID 3584203) is 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one is Cc1ccc2nc(-c3ccc4c(c3)NC(=O)CO4)cn2c1.
What is the InChIKey of 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one?
The InChIKey is RUIVPKHWWWKTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c1-10-2-5-15-17-13(8-19(15)7-10)11-3-4-14-12(6-11)18-16(20)9-21-14/h2-8H,9H2,1H3,(H,18,20).
What are the key properties of 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one?
6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one has a molecular weight of 279.30 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-methylimidazo[1,2-a]pyridin-2-yl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 3584203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).