C20H28N2O6S2 — CID 3585526
N,N'-bis(3-hydroxyphenyl)octane-1,8-disulfonamide (PubChem CID 3585526) has the molecular formula C20H28N2O6S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N,N'-bis(3-hydroxyphenyl)octane-1,8-disulfonamide.
| Compound Name | N,N'-bis(3-hydroxyphenyl)octane-1,8-disulfonamide |
|---|---|
| PubChem CID | 3585526 |
| Molecular Formula | C20H28N2O6S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N,N'-bis(3-hydroxyphenyl)octane-1,8-disulfonamide |
| SMILES | O=S(=O)(CCCCCCCCS(=O)(=O)Nc1cccc(O)c1)Nc1cccc(O)c1 |
| InChI | InChI=1S/C20H28N2O6S2/c23-19-11-7-9-17(15-19)21-29(25,26)13-5-3-1-2-4-6-14-30(27,28)22-18-10-8-12-20(24)16-18/h7-12,15-16,21-24H,1-6,13-14H2 |
| InChIKey | IKONSQVGSHKWCQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|