C20H25ClN2O3S — CID 3585682
1-(4-chloro-2,5-dimethoxyphenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea (PubChem CID 3585682) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 3585682 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea |
| SMILES | COc1cc(NC(=S)NC(C)COc2c(C)cccc2C)c(OC)cc1Cl |
| InChI | InChI=1S/C20H25ClN2O3S/c1-12-7-6-8-13(2)19(12)26-11-14(3)22-20(27)23-16-10-17(24-4)15(21)9-18(16)25-5/h6-10,14H,11H2,1-5H3,(H2,22,23,27) |
| InChIKey | XYAIPSUPMRFIAR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|