C25H26N4O2 — CID 35857881
N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]-4-phenylbenzamide (PubChem CID 35857881) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]-4-phenylbenzamide.
| Compound Name | N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 35857881 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[2-oxo-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]-4-phenylbenzamide |
| SMILES | O=C(NCC(=O)N1CCN(Cc2ccncc2)CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N4O2/c30-24(29-16-14-28(15-17-29)19-20-10-12-26-13-11-20)18-27-25(31)23-8-6-22(7-9-23)21-4-2-1-3-5-21/h1-13H,14-19H2,(H,27,31) |
| InChIKey | XCBCKVOSUSRRDE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |