C21H26N4O2S3 — CID 3585806
1,4-dimethyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-thiomorpholin-4-ylpyridine-3-carbonitrile (PubChem CID 3585806) has the molecular formula C21H26N4O2S3 and a molecular weight of 462.67 g/mol. Its IUPAC name is 1,4-dimethyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-thiomorpholin-4-ylpyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-thiomorpholin-4-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3585806 |
| Molecular Formula | C21H26N4O2S3 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1,4-dimethyl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-thiomorpholin-4-ylpyridine-3-carbonitrile |
| SMILES | CCCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(C)c2N2CCSCC2)SC1=S |
| InChI | InChI=1S/C21H26N4O2S3/c1-4-5-6-7-25-20(27)17(30-21(25)28)12-15-14(2)16(13-22)19(26)23(3)18(15)24-8-10-29-11-9-24/h12H,4-11H2,1-3H3 |
| InChIKey | KVJCSAGEAQNWOW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|