About 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide
4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 3586494) has the molecular formula C14H10N2O4S
and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| PubChem CID | 3586494 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C14H10N2O4S/c15-21(19,20)10-7-5-9(6-8-10)16-13(17)11-3-1-2-4-12(11)14(16)18/h1-8H,(H2,15,19,20) |
| InChIKey | OUGLLSMFRGBCIL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
The IUPAC name of 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (CID 3586494) is 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
The canonical SMILES for 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide is NS(=O)(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
The InChIKey is OUGLLSMFRGBCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O4S/c15-21(19,20)10-7-5-9(6-8-10)16-13(17)11-3-1-2-4-12(11)14(16)18/h1-8H,(H2,15,19,20).
What are the key properties of 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide has a molecular weight of 302.31 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide is sourced from PubChem (CID 3586494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).