C22H20N4O7 — CID 3586516
methyl 2-[3-[[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate (PubChem CID 3586516) has the molecular formula C22H20N4O7 and a molecular weight of 452.42 g/mol. Its IUPAC name is methyl 2-[3-[[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate |
|---|---|
| PubChem CID | 3586516 |
| Molecular Formula | C22H20N4O7 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | methyl 2-[3-[[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(O)c(/N=N/C(=O)CNC(=O)C2COc3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C22H20N4O7/c1-31-19(28)11-26-14-7-3-2-6-13(14)20(22(26)30)25-24-18(27)10-23-21(29)17-12-32-15-8-4-5-9-16(15)33-17/h2-9,17,30H,10-12H2,1H3,(H,23,29)/b25-24+ |
| InChIKey | IZISGGACHMBVNZ-OCOZRVBESA-N |
| XLogP | 2.09 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|