C21H18FNO4S3 — CID 3586773
3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 3586773) has the molecular formula C21H18FNO4S3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 3586773 |
| Molecular Formula | C21H18FNO4S3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | COc1cc2sc(C=Cc3cccc(F)c3)[n+](CCCS(=O)(=O)[O-])c2c2sccc12 |
| InChI | InChI=1S/C21H18FNO4S3/c1-27-17-13-18-20(21-16(17)8-10-28-21)23(9-3-11-30(24,25)26)19(29-18)7-6-14-4-2-5-15(22)12-14/h2,4-8,10,12-13H,3,9,11H2,1H3 |
| InChIKey | NWGRNFUCJMJJTB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|