C21H19FNO4S3+ — CID 3586774
3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 3586774) has the molecular formula C21H19FNO4S3+ and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3586774 |
| Molecular Formula | C21H19FNO4S3+ |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 3-[2-[2-(3-fluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | COc1cc2sc(C=Cc3cccc(F)c3)[n+](CCCS(=O)(=O)O)c2c2sccc12 |
| InChI | InChI=1S/C21H18FNO4S3/c1-27-17-13-18-20(21-16(17)8-10-28-21)23(9-3-11-30(24,25)26)19(29-18)7-6-14-4-2-5-15(22)12-14/h2,4-8,10,12-13H,3,9,11H2,1H3/p+1 |
| InChIKey | NWGRNFUCJMJJTB-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|