C19H18IN3O — CID 3586899
1-(2-ethoxyphenyl)-3-(2-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 3586899) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-(2-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
| Compound Name | 1-(2-ethoxyphenyl)-3-(2-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 3586899 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-(2-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | CCOc1ccccc1-n1nc(-c2ccccc2I)c2c1NCC2 |
| InChI | InChI=1S/C19H18IN3O/c1-2-24-17-10-6-5-9-16(17)23-19-14(11-12-21-19)18(22-23)13-7-3-4-8-15(13)20/h3-10,21H,2,11-12H2,1H3 |
| InChIKey | KPNCVVNKZCUALT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|