C19H21N7O3S — CID 35871284
4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonamide (PubChem CID 35871284) has the molecular formula C19H21N7O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is 4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 35871284 |
| Molecular Formula | C19H21N7O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H21N7O3S/c20-30(27,28)16-8-6-15(7-9-16)22-18-23-17(21-14-4-2-1-3-5-14)24-19(25-18)26-10-12-29-13-11-26/h1-9H,10-13H2,(H2,20,27,28)(H2,21,22,23,24,25) |
| InChIKey | HZLORASHKAHONJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |