About 1,1,2-trifluoropenta-1,3-diene
1,1,2-trifluoropenta-1,3-diene (PubChem CID 3587349) has the molecular formula C5H5F3
and a molecular weight of 122.09 g/mol. Its IUPAC name is 1,1,2-trifluoropenta-1,3-diene.
Molecular Properties
| Compound Name | 1,1,2-trifluoropenta-1,3-diene |
| PubChem CID | 3587349 |
| Molecular Formula | C5H5F3 |
| Molecular Weight | 122.09 g/mol |
| Exact Mass | 122.03 |
| IUPAC Name | 1,1,2-trifluoropenta-1,3-diene |
| SMILES | CC=CC(F)=C(F)F |
| InChI | InChI=1S/C5H5F3/c1-2-3-4(6)5(7)8/h2-3H,1H3 |
| InChIKey | GINRQJQYVSIGAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-trifluoropenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trifluoropenta-1,3-diene?
The IUPAC name of 1,1,2-trifluoropenta-1,3-diene (CID 3587349) is 1,1,2-trifluoropenta-1,3-diene.
What is the SMILES notation for 1,1,2-trifluoropenta-1,3-diene?
The canonical SMILES for 1,1,2-trifluoropenta-1,3-diene is CC=CC(F)=C(F)F.
What is the InChIKey of 1,1,2-trifluoropenta-1,3-diene?
The InChIKey is GINRQJQYVSIGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3/c1-2-3-4(6)5(7)8/h2-3H,1H3.
What are the key properties of 1,1,2-trifluoropenta-1,3-diene?
1,1,2-trifluoropenta-1,3-diene has a molecular weight of 122.09 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoropenta-1,3-diene is sourced from PubChem (CID 3587349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).