C18H18F3N3O — CID 35875973
[4-(3-methylphenyl)piperazin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 35875973) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is [4-(3-methylphenyl)piperazin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [4-(3-methylphenyl)piperazin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 35875973 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [4-(3-methylphenyl)piperazin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(C(F)(F)F)nc3)CC2)c1 |
| InChI | InChI=1S/C18H18F3N3O/c1-13-3-2-4-15(11-13)23-7-9-24(10-8-23)17(25)14-5-6-16(22-12-14)18(19,20)21/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | JRLFIOUUPJPJTN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |