C13Cl4F4N2O2S — CID 3587841
4,5,6,7-tetrachloro-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]isoindole-1,3-dione (PubChem CID 3587841) has the molecular formula C13Cl4F4N2O2S and a molecular weight of 466.03 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3587841 |
| Molecular Formula | C13Cl4F4N2O2S |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 463.84 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1Sc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13Cl4F4N2O2S/c14-3-1-2(4(15)6(17)5(3)16)13(25)23(12(1)24)26-9-7(18)10(20)22-11(21)8(9)19 |
| InChIKey | RIAZVALSYSMLDC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|