C22H20ClIN2O3S — CID 3587914
4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]-N-(4-iodo-2-methylphenyl)benzamide (PubChem CID 3587914) has the molecular formula C22H20ClIN2O3S and a molecular weight of 554.84 g/mol. Its IUPAC name is 4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]-N-(4-iodo-2-methylphenyl)benzamide.
| Compound Name | 4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]-N-(4-iodo-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 3587914 |
| Molecular Formula | C22H20ClIN2O3S |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | 4-chloro-3-[(3,5-dimethylphenyl)sulfamoyl]-N-(4-iodo-2-methylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2cc(C(=O)Nc3ccc(I)cc3C)ccc2Cl)c1 |
| InChI | InChI=1S/C22H20ClIN2O3S/c1-13-8-14(2)10-18(9-13)26-30(28,29)21-12-16(4-6-19(21)23)22(27)25-20-7-5-17(24)11-15(20)3/h4-12,26H,1-3H3,(H,25,27) |
| InChIKey | SQMWAESNMFMECS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|