C32H20N4O3 — CID 3588198
6-amino-2-[4-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 3588198) has the molecular formula C32H20N4O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is 6-amino-2-[4-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-amino-2-[4-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 3588198 |
| Molecular Formula | C32H20N4O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 6-amino-2-[4-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Nc1ccc2c3c(cccc13)C(=O)N(c1ccc(-c3nnc(-c4ccc(-c5ccccc5)cc4)o3)cc1)C2=O |
| InChI | InChI=1S/C32H20N4O3/c33-27-18-17-26-28-24(27)7-4-8-25(28)31(37)36(32(26)38)23-15-13-22(14-16-23)30-35-34-29(39-30)21-11-9-20(10-12-21)19-5-2-1-3-6-19/h1-18H,33H2 |
| InChIKey | QDTOZTCHZRSJFV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|