C38H51ClFNO6 — CID 3590987
2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 3590987) has the molecular formula C38H51ClFNO6 and a molecular weight of 672.28 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 3590987 |
| Molecular Formula | C38H51ClFNO6 |
| Molecular Weight | 672.28 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN(CC(O)CO)CC1CCCO1 |
| InChI | InChI=1S/C38H51ClFNO6/c1-34-11-8-24(43)18-36(34)14-15-38(28(19-36)31(45)17-27-29(39)6-3-7-30(27)40)32(34)9-12-35(2)33(38)10-13-37(35,46)23-41(20-25(44)22-42)21-26-5-4-16-47-26/h3,6-7,14-15,19,24-26,32-33,42-44,46H,4-5,8-13,16-18,20-23H2,1-2H3 |
| InChIKey | CHAFXPSULILFGY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|