C10H13BrN4O3 — CID 3591427
8-bromo-1,3-dimethyl-7-(2-oxopropyl)-4,5-dihydropurine-2,6-dione (PubChem CID 3591427) has the molecular formula C10H13BrN4O3 and a molecular weight of 317.14 g/mol. Its IUPAC name is 8-bromo-1,3-dimethyl-7-(2-oxopropyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-bromo-1,3-dimethyl-7-(2-oxopropyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 3591427 |
| Molecular Formula | C10H13BrN4O3 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 8-bromo-1,3-dimethyl-7-(2-oxopropyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CC(=O)CN1C(Br)=NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C10H13BrN4O3/c1-5(16)4-15-6-7(12-9(15)11)13(2)10(18)14(3)8(6)17/h6-7H,4H2,1-3H3 |
| InChIKey | KKOITUWXCQEYGT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|