C29H22N2O6 — CID 3591945
N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2-(3-methoxyphenoxy)acetamide (PubChem CID 3591945) has the molecular formula C29H22N2O6 and a molecular weight of 494.50 g/mol. Its IUPAC name is N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 3591945 |
| Molecular Formula | C29H22N2O6 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)Nc2cccc(Oc3ccc4c(c3)C(=O)N(c3ccccc3)C4=O)c2)c1 |
| InChI | InChI=1S/C29H22N2O6/c1-35-21-10-6-11-22(16-21)36-18-27(32)30-19-7-5-12-23(15-19)37-24-13-14-25-26(17-24)29(34)31(28(25)33)20-8-3-2-4-9-20/h2-17H,18H2,1H3,(H,30,32) |
| InChIKey | VKPQZTCPIGPCCJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|