C22H26N4S — CID 3593276
2-[(2,6-dimethylpiperidin-1-yl)methyl]-4,5-diphenyl-1,2,4-triazole-3-thione (PubChem CID 3593276) has the molecular formula C22H26N4S and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-[(2,6-dimethylpiperidin-1-yl)methyl]-4,5-diphenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2,6-dimethylpiperidin-1-yl)methyl]-4,5-diphenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 3593276 |
| Molecular Formula | C22H26N4S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-[(2,6-dimethylpiperidin-1-yl)methyl]-4,5-diphenyl-1,2,4-triazole-3-thione |
| SMILES | CC1CCCC(C)N1Cn1nc(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C22H26N4S/c1-17-10-9-11-18(2)24(17)16-25-22(27)26(20-14-7-4-8-15-20)21(23-25)19-12-5-3-6-13-19/h3-8,12-15,17-18H,9-11,16H2,1-2H3 |
| InChIKey | TUYKJMLVUBXSOK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|