About 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole
3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole (PubChem CID 3593539) has the molecular formula C19H17FN4O2
and a molecular weight of 352.37 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole.
Molecular Properties
| Compound Name | 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole |
| PubChem CID | 3593539 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-n1nc(Cc2ccccc2F)c2c1NCC2 |
| InChI | InChI=1S/C19H17FN4O2/c1-12-6-7-14(24(25)26)11-18(12)23-19-15(8-9-21-19)17(22-23)10-13-4-2-3-5-16(13)20/h2-7,11,21H,8-10H2,1H3 |
| InChIKey | BEGCEQQYHZNNAC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
The IUPAC name of 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole (CID 3593539) is 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole.
What is the SMILES notation for 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
The canonical SMILES for 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole is Cc1ccc([N+](=O)[O-])cc1-n1nc(Cc2ccccc2F)c2c1NCC2.
What is the InChIKey of 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
The InChIKey is BEGCEQQYHZNNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN4O2/c1-12-6-7-14(24(25)26)11-18(12)23-19-15(8-9-21-19)17(22-23)10-13-4-2-3-5-16(13)20/h2-7,11,21H,8-10H2,1H3.
What are the key properties of 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole?
3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole has a molecular weight of 352.37 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-fluorophenyl)methyl]-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole is sourced from PubChem (CID 3593539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).