C21H20F3N5O2S — CID 3593679
N-phenyl-N-propan-2-yl-2-[4-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetamide (PubChem CID 3593679) has the molecular formula C21H20F3N5O2S and a molecular weight of 463.49 g/mol. Its IUPAC name is N-phenyl-N-propan-2-yl-2-[4-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetamide.
| Compound Name | N-phenyl-N-propan-2-yl-2-[4-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 3593679 |
| Molecular Formula | C21H20F3N5O2S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-phenyl-N-propan-2-yl-2-[4-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetamide |
| SMILES | CC(C)N(C(=O)COc1ccc(C=Nn2c(C(F)(F)F)n[nH]c2=S)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H20F3N5O2S/c1-14(2)28(16-6-4-3-5-7-16)18(30)13-31-17-10-8-15(9-11-17)12-25-29-19(21(22,23)24)26-27-20(29)32/h3-12,14H,13H2,1-2H3,(H,27,32) |
| InChIKey | GRLKXVPYYUQHAH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|