C9H9F4N3O — CID 3594032
N-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholin-4-amine (PubChem CID 3594032) has the molecular formula C9H9F4N3O and a molecular weight of 251.18 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholin-4-amine.
| Compound Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholin-4-amine |
|---|---|
| PubChem CID | 3594032 |
| Molecular Formula | C9H9F4N3O |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NN2CCOCC2)c1F |
| InChI | InChI=1S/C9H9F4N3O/c10-5-7(6(11)9(13)14-8(5)12)15-16-1-3-17-4-2-16/h1-4H2,(H,14,15) |
| InChIKey | DMBCMKZYYGWVFR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|