About [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate (PubChem CID 3594294) has the molecular formula C18H25NO5S
and a molecular weight of 367.47 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate |
| PubChem CID | 3594294 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(C(C)(C)C)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H25NO5S/c1-18(2,3)14-7-5-13(6-8-14)17(21)24-11-16(20)19(4)15-9-10-25(22,23)12-15/h5-8,15H,9-12H2,1-4H3 |
| InChIKey | BOFYXKMYUYVOMT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate (CID 3594294) is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate is CN(C(=O)COC(=O)c1ccc(C(C)(C)C)cc1)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate?
The InChIKey is BOFYXKMYUYVOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO5S/c1-18(2,3)14-7-5-13(6-8-14)17(21)24-11-16(20)19(4)15-9-10-25(22,23)12-15/h5-8,15H,9-12H2,1-4H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate?
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate has a molecular weight of 367.47 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-tert-butylbenzoate is sourced from PubChem (CID 3594294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).