C23H23NO2 — CID 3594347
7,7-dimethyl-1,4-diphenyl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 3594347) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 7,7-dimethyl-1,4-diphenyl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 7,7-dimethyl-1,4-diphenyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 3594347 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 7,7-dimethyl-1,4-diphenyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccccc1)C(=O)CC2c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-23(2)14-19-22(20(25)15-23)18(16-9-5-3-6-10-16)13-21(26)24(19)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3 |
| InChIKey | REHUPAQDLIEZJW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |