C23H24ClN3O4S — CID 3594676
2-(2-chlorophenoxy)ethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3594676) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | 2-(2-chlorophenoxy)ethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3594676 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(/N=C(\SCCOc2ccccc2Cl)c2c(O)n(C)c(=O)n(C)c2=O)cc1C |
| InChI | InChI=1S/C23H24ClN3O4S/c1-14-9-10-16(13-15(14)2)25-20(19-21(28)26(3)23(30)27(4)22(19)29)32-12-11-31-18-8-6-5-7-17(18)24/h5-10,13,28H,11-12H2,1-4H3/b25-20- |
| InChIKey | GZYFQGLRFXGRLW-QQTULTPQSA-N |
| XLogP | 3.95 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|