About [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone
[4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone (PubChem CID 3595025) has the molecular formula C18H16F2N2O6S
and a molecular weight of 426.40 g/mol. Its IUPAC name is [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone |
| PubChem CID | 3595025 |
| Molecular Formula | C18H16F2N2O6S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(S(=O)(=O)Cc2cc(F)ccc2F)c([N+](=O)[O-])c1)N1CCOCC1 |
| InChI | InChI=1S/C18H16F2N2O6S/c19-14-2-3-15(20)13(9-14)11-29(26,27)17-4-1-12(10-16(17)22(24)25)18(23)21-5-7-28-8-6-21/h1-4,9-10H,5-8,11H2 |
| InChIKey | CHQOJJQBUSIBEL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone?
The IUPAC name of [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone (CID 3595025) is [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone?
The canonical SMILES for [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone is O=C(c1ccc(S(=O)(=O)Cc2cc(F)ccc2F)c([N+](=O)[O-])c1)N1CCOCC1.
What is the InChIKey of [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone?
The InChIKey is CHQOJJQBUSIBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N2O6S/c19-14-2-3-15(20)13(9-14)11-29(26,27)17-4-1-12(10-16(17)22(24)25)18(23)21-5-7-28-8-6-21/h1-4,9-10H,5-8,11H2.
What are the key properties of [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone?
[4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone has a molecular weight of 426.40 g/mol, XLogP of 2.32, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,5-difluorophenyl)methylsulfonyl]-3-nitrophenyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 3595025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).