C23H24BrN2O2+ — CID 3595239
(4-methylphenyl) 2-[3-(4-bromophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]acetate (PubChem CID 3595239) has the molecular formula C23H24BrN2O2+ and a molecular weight of 440.36 g/mol. Its IUPAC name is (4-methylphenyl) 2-[3-(4-bromophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]acetate.
| Compound Name | (4-methylphenyl) 2-[3-(4-bromophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 3595239 |
| Molecular Formula | C23H24BrN2O2+ |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (4-methylphenyl) 2-[3-(4-bromophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]acetate |
| SMILES | Cc1ccc(OC(=O)C[n+]2cc(-c3ccc(Br)cc3)n3c2CCCCC3)cc1 |
| InChI | InChI=1S/C23H24BrN2O2/c1-17-6-12-20(13-7-17)28-23(27)16-25-15-21(18-8-10-19(24)11-9-18)26-14-4-2-3-5-22(25)26/h6-13,15H,2-5,14,16H2,1H3/q+1 |
| InChIKey | SKIRDWGAOMXYFN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|