C15H10N2O2 — CID 3595287
6,6a-dihydroisoindolo[2,3-a]quinazoline-5,11-dione (PubChem CID 3595287) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 6,6a-dihydroisoindolo[2,3-a]quinazoline-5,11-dione.
| Compound Name | 6,6a-dihydroisoindolo[2,3-a]quinazoline-5,11-dione |
|---|---|
| PubChem CID | 3595287 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 6,6a-dihydroisoindolo[2,3-a]quinazoline-5,11-dione |
| SMILES | O=C1NC2c3ccccc3C(=O)N2c2ccccc21 |
| InChI | InChI=1S/C15H10N2O2/c18-14-11-7-3-4-8-12(11)17-13(16-14)9-5-1-2-6-10(9)15(17)19/h1-8,13H,(H,16,18) |
| InChIKey | VLBOEFXWNLNKHU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |