About 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide
3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide (PubChem CID 3595475) has the molecular formula C14H25N3O2S
and a molecular weight of 299.44 g/mol. Its IUPAC name is 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide |
| PubChem CID | 3595475 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide |
| SMILES | CCCCNc1ccc(S(=O)(=O)N(CC)CC)cc1N |
| InChI | InChI=1S/C14H25N3O2S/c1-4-7-10-16-14-9-8-12(11-13(14)15)20(18,19)17(5-2)6-3/h8-9,11,16H,4-7,10,15H2,1-3H3 |
| InChIKey | WHTYVNKWRFHFHQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide?
The IUPAC name of 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide (CID 3595475) is 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide.
What is the SMILES notation for 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide?
The canonical SMILES for 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide is CCCCNc1ccc(S(=O)(=O)N(CC)CC)cc1N.
What is the InChIKey of 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide?
The InChIKey is WHTYVNKWRFHFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2S/c1-4-7-10-16-14-9-8-12(11-13(14)15)20(18,19)17(5-2)6-3/h8-9,11,16H,4-7,10,15H2,1-3H3.
What are the key properties of 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide?
3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide has a molecular weight of 299.44 g/mol, XLogP of 2.51, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-(butylamino)-N,N-diethylbenzenesulfonamide is sourced from PubChem (CID 3595475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).